C16H10Cl2FN3O — CID 45030500
N-(2,5-dichlorophenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 45030500) has the molecular formula C16H10Cl2FN3O and a molecular weight of 350.18 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 45030500 |
| Molecular Formula | C16H10Cl2FN3O |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C16H10Cl2FN3O/c17-10-3-6-12(18)14(7-10)20-16(23)15-8-13(21-22-15)9-1-4-11(19)5-2-9/h1-8H,(H,20,23)(H,21,22) |
| InChIKey | LSUGQSSRCMLBBB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |