C16H11ClFN3O — CID 46920010
3-(4-chlorophenyl)-N-(3-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 46920010) has the molecular formula C16H11ClFN3O and a molecular weight of 315.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(3-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46920010 |
| Molecular Formula | C16H11ClFN3O |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C16H11ClFN3O/c17-11-6-4-10(5-7-11)14-9-15(21-20-14)16(22)19-13-3-1-2-12(18)8-13/h1-9H,(H,19,22)(H,20,21) |
| InChIKey | WXTFDNAECSKUDR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |