C12H8BrN5O3S — CID 135803309
4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135803309) has the molecular formula C12H8BrN5O3S and a molecular weight of 382.20 g/mol. Its IUPAC name is 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803309 |
| Molecular Formula | C12H8BrN5O3S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3n[nH]c([N+](=O)[O-])c3Br)sc2c1 |
| InChI | InChI=1S/C12H8BrN5O3S/c1-5-2-3-6-7(4-5)22-12(14-6)15-11(19)9-8(13)10(17-16-9)18(20)21/h2-4H,1H3,(H,16,17)(H,14,15,19) |
| InChIKey | OOJQOTUXDSEOFM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|