C16H12FN3O3S — CID 46491477
3-fluoro-4-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide (PubChem CID 46491477) has the molecular formula C16H12FN3O3S and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide.
| Compound Name | 3-fluoro-4-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 46491477 |
| Molecular Formula | C16H12FN3O3S |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-fluoro-4-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
| SMILES | Cc1ccc2nc(NC(=O)c3cc(F)c(C)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C16H12FN3O3S/c1-8-3-4-12-14(5-8)24-16(18-12)19-15(21)10-6-11(17)9(2)13(7-10)20(22)23/h3-7H,1-2H3,(H,18,19,21) |
| InChIKey | QVKFUZXYWWMMGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|