C15H9ClF2N2OS — CID 2701477
2-chloro-4,5-difluoro-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 2701477) has the molecular formula C15H9ClF2N2OS and a molecular weight of 338.77 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2701477 |
| Molecular Formula | C15H9ClF2N2OS |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1ccc2nc(NC(=O)c3cc(F)c(F)cc3Cl)sc2c1 |
| InChI | InChI=1S/C15H9ClF2N2OS/c1-7-2-3-12-13(4-7)22-15(19-12)20-14(21)8-5-10(17)11(18)6-9(8)16/h2-6H,1H3,(H,19,20,21) |
| InChIKey | CRTADXOPRYGFNJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|