C10H4BrClF3N5O3 — CID 135748971
4-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135748971) has the molecular formula C10H4BrClF3N5O3 and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135748971 |
| Molecular Formula | C10H4BrClF3N5O3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | 4-bromo-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ncc(C(F)(F)F)cc1Cl)c1n[nH]c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C10H4BrClF3N5O3/c11-5-6(18-19-8(5)20(22)23)9(21)17-7-4(12)1-3(2-16-7)10(13,14)15/h1-2H,(H,18,19)(H,16,17,21) |
| InChIKey | ZYTVGDYLLIVBEK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|