C3H5N6O6Sn+5 — CID 175801703
azanium;tin(4+);2,4,5-trinitro-1H-imidazole (PubChem CID 175801703) has the molecular formula C3H5N6O6Sn+5 and a molecular weight of 339.82 g/mol. Its IUPAC name is azanium;tin(4+);2,4,5-trinitro-1H-imidazole.
| Compound Name | azanium;tin(4+);2,4,5-trinitro-1H-imidazole |
|---|---|
| PubChem CID | 175801703 |
| Molecular Formula | C3H5N6O6Sn+5 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 340.93 |
| IUPAC Name | azanium;tin(4+);2,4,5-trinitro-1H-imidazole |
| SMILES | O=[N+]([O-])c1nc([N+](=O)[O-])c([N+](=O)[O-])[nH]1.[NH4+].[Sn+4] |
| InChI | InChI=1S/C3HN5O6.H3N.Sn/c9-6(10)1-2(7(11)12)5-3(4-1)8(13)14;;/h(H,4,5);1H3;/q;;+4/p+1 |
| InChIKey | YLCWGBHUWHGUAK-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 194.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|