C5H2N8O6 — CID 136798500
3-(4,5-dinitro-1H-pyrazol-3-yl)-5-nitro-1H-1,2,4-triazole (PubChem CID 136798500) has the molecular formula C5H2N8O6 and a molecular weight of 270.12 g/mol. Its IUPAC name is 3-(4,5-dinitro-1H-pyrazol-3-yl)-5-nitro-1H-1,2,4-triazole.
| Compound Name | 3-(4,5-dinitro-1H-pyrazol-3-yl)-5-nitro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 136798500 |
| Molecular Formula | C5H2N8O6 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 3-(4,5-dinitro-1H-pyrazol-3-yl)-5-nitro-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(-c2n[nH]c([N+](=O)[O-])c2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C5H2N8O6/c14-11(15)2-1(7-9-4(2)12(16)17)3-6-5(10-8-3)13(18)19/h(H,7,9)(H,6,8,10) |
| InChIKey | RUFHTWFQCPPQGD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 199.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|