C2H2N5NaO4 — CID 173200248
sodium;3,5-dinitro-1H-1,2,4-triazole;hydride (PubChem CID 173200248) has the molecular formula C2H2N5NaO4 and a molecular weight of 183.06 g/mol. Its IUPAC name is sodium;3,5-dinitro-1H-1,2,4-triazole;hydride.
| Compound Name | sodium;3,5-dinitro-1H-1,2,4-triazole;hydride |
|---|---|
| PubChem CID | 173200248 |
| Molecular Formula | C2H2N5NaO4 |
| Molecular Weight | 183.06 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | sodium;3,5-dinitro-1H-1,2,4-triazole;hydride |
| SMILES | O=[N+]([O-])c1n[nH]c([N+](=O)[O-])n1.[H-].[Na+] |
| InChI | InChI=1S/C2HN5O4.Na.H/c8-6(9)1-3-2(5-4-1)7(10)11;;/h(H,3,4,5);;/q;+1;-1 |
| InChIKey | SPJJOTWSLSAZCM-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.06 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|