About 5-nitro-2H-tetrazole;hydroiodide
5-nitro-2H-tetrazole;hydroiodide (PubChem CID 159499881) has the molecular formula CH2IN5O2
and a molecular weight of 242.96 g/mol. Its IUPAC name is 5-nitro-2H-tetrazole;hydroiodide.
Molecular Properties
| Compound Name | 5-nitro-2H-tetrazole;hydroiodide |
| PubChem CID | 159499881 |
| Molecular Formula | CH2IN5O2 |
| Molecular Weight | 242.96 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | 5-nitro-2H-tetrazole;hydroiodide |
| SMILES | I.O=[N+]([O-])c1nn[nH]n1 |
| InChI | InChI=1S/CHN5O2.HI/c7-6(8)1-2-4-5-3-1;/h(H,2,3,4,5);1H |
| InChIKey | ULVZIWIZLIQJMY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.96 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2H-tetrazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2H-tetrazole;hydroiodide?
The IUPAC name of 5-nitro-2H-tetrazole;hydroiodide (CID 159499881) is 5-nitro-2H-tetrazole;hydroiodide.
What is the SMILES notation for 5-nitro-2H-tetrazole;hydroiodide?
The canonical SMILES for 5-nitro-2H-tetrazole;hydroiodide is I.O=[N+]([O-])c1nn[nH]n1.
What is the InChIKey of 5-nitro-2H-tetrazole;hydroiodide?
The InChIKey is ULVZIWIZLIQJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/CHN5O2.HI/c7-6(8)1-2-4-5-3-1;/h(H,2,3,4,5);1H.
What are the key properties of 5-nitro-2H-tetrazole;hydroiodide?
5-nitro-2H-tetrazole;hydroiodide has a molecular weight of 242.96 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2H-tetrazole;hydroiodide is sourced from PubChem (CID 159499881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).