C6H2N18O4 — CID 139178749
(E)-bis[5-nitro-2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]diazene (PubChem CID 139178749) has the molecular formula C6H2N18O4 and a molecular weight of 390.20 g/mol. Its IUPAC name is (E)-bis[5-nitro-2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]diazene.
| Compound Name | (E)-bis[5-nitro-2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]diazene |
|---|---|
| PubChem CID | 139178749 |
| Molecular Formula | C6H2N18O4 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (E)-bis[5-nitro-2-(2H-tetrazol-5-yl)-1,2,4-triazol-3-yl]diazene |
| SMILES | O=[N+]([O-])c1nc(/N=N/c2nc([N+](=O)[O-])nn2-c2nn[nH]n2)n(-c2nn[nH]n2)n1 |
| InChI | InChI=1S/C6H2N18O4/c25-23(26)3-7-1(21(15-3)5-11-17-18-12-5)9-10-2-8-4(24(27)28)16-22(2)6-13-19-20-14-6/h(H,11,12,17,18)(H,13,14,19,20)/b10-9+ |
| InChIKey | QTQWFRXFFMTPCS-MDZDMXLPSA-N |
| XLogP | -1.89 |
| TPSA | 281.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|