C4H2ClN7O2 — CID 3322778
1-(5-chloro-1H-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole (PubChem CID 3322778) has the molecular formula C4H2ClN7O2 and a molecular weight of 215.56 g/mol. Its IUPAC name is 1-(5-chloro-1H-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole.
| Compound Name | 1-(5-chloro-1H-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 3322778 |
| Molecular Formula | C4H2ClN7O2 |
| Molecular Weight | 215.56 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 1-(5-chloro-1H-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn(-c2n[nH]c(Cl)n2)n1 |
| InChI | InChI=1S/C4H2ClN7O2/c5-2-7-4(9-8-2)11-1-6-3(10-11)12(13)14/h1H,(H,7,8,9) |
| InChIKey | BXIKJAWJJCXBQB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.56 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|