C4H4BrN7O2 — CID 159015425
5-bromo-1H-1,2,4-triazole;5-nitro-1H-1,2,4-triazole (PubChem CID 159015425) has the molecular formula C4H4BrN7O2 and a molecular weight of 262.03 g/mol. Its IUPAC name is 5-bromo-1H-1,2,4-triazole;5-nitro-1H-1,2,4-triazole.
| Compound Name | 5-bromo-1H-1,2,4-triazole;5-nitro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 159015425 |
| Molecular Formula | C4H4BrN7O2 |
| Molecular Weight | 262.03 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 5-bromo-1H-1,2,4-triazole;5-nitro-1H-1,2,4-triazole |
| SMILES | Brc1ncn[nH]1.O=[N+]([O-])c1ncn[nH]1 |
| InChI | InChI=1S/C2H2BrN3.C2H2N4O2/c3-2-4-1-5-6-2;7-6(8)2-3-1-4-5-2/h1H,(H,4,5,6);1H,(H,3,4,5) |
| InChIKey | JTAIUQVKHMFLBS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.03 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|