About sodium;hydride;5-nitro-2H-tetrazole
sodium;hydride;5-nitro-2H-tetrazole (PubChem CID 173097476) has the molecular formula CH2N5NaO2
and a molecular weight of 139.05 g/mol. Its IUPAC name is sodium;hydride;5-nitro-2H-tetrazole.
Molecular Properties
| Compound Name | sodium;hydride;5-nitro-2H-tetrazole |
| PubChem CID | 173097476 |
| Molecular Formula | CH2N5NaO2 |
| Molecular Weight | 139.05 g/mol |
| Exact Mass | 139.01 |
| IUPAC Name | sodium;hydride;5-nitro-2H-tetrazole |
| SMILES | O=[N+]([O-])c1nn[nH]n1.[H-].[Na+] |
| InChI | InChI=1S/CHN5O2.Na.H/c7-6(8)1-2-4-5-3-1;;/h(H,2,3,4,5);;/q;+1;-1 |
| InChIKey | PEKNSFOVIJPYTF-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.05 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;5-nitro-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;5-nitro-2H-tetrazole?
The IUPAC name of sodium;hydride;5-nitro-2H-tetrazole (CID 173097476) is sodium;hydride;5-nitro-2H-tetrazole.
What is the SMILES notation for sodium;hydride;5-nitro-2H-tetrazole?
The canonical SMILES for sodium;hydride;5-nitro-2H-tetrazole is O=[N+]([O-])c1nn[nH]n1.[H-].[Na+].
What is the InChIKey of sodium;hydride;5-nitro-2H-tetrazole?
The InChIKey is PEKNSFOVIJPYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/CHN5O2.Na.H/c7-6(8)1-2-4-5-3-1;;/h(H,2,3,4,5);;/q;+1;-1.
What are the key properties of sodium;hydride;5-nitro-2H-tetrazole?
sodium;hydride;5-nitro-2H-tetrazole has a molecular weight of 139.05 g/mol, XLogP of -3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;5-nitro-2H-tetrazole is sourced from PubChem (CID 173097476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).