About 1-methyltetrazole;5-nitro-2H-tetrazole
1-methyltetrazole;5-nitro-2H-tetrazole (PubChem CID 146465693) has the molecular formula C3H5N9O2
and a molecular weight of 199.13 g/mol. Its IUPAC name is 1-methyltetrazole;5-nitro-2H-tetrazole.
Molecular Properties
| Compound Name | 1-methyltetrazole;5-nitro-2H-tetrazole |
| PubChem CID | 146465693 |
| Molecular Formula | C3H5N9O2 |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1-methyltetrazole;5-nitro-2H-tetrazole |
| SMILES | Cn1cnnn1.O=[N+]([O-])c1nn[nH]n1 |
| InChI | InChI=1S/C2H4N4.CHN5O2/c1-6-2-3-4-5-6;7-6(8)1-2-4-5-3-1/h2H,1H3;(H,2,3,4,5) |
| InChIKey | MNFHXQYGBAYEBI-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyltetrazole;5-nitro-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyltetrazole;5-nitro-2H-tetrazole?
The IUPAC name of 1-methyltetrazole;5-nitro-2H-tetrazole (CID 146465693) is 1-methyltetrazole;5-nitro-2H-tetrazole.
What is the SMILES notation for 1-methyltetrazole;5-nitro-2H-tetrazole?
The canonical SMILES for 1-methyltetrazole;5-nitro-2H-tetrazole is Cn1cnnn1.O=[N+]([O-])c1nn[nH]n1.
What is the InChIKey of 1-methyltetrazole;5-nitro-2H-tetrazole?
The InChIKey is MNFHXQYGBAYEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.CHN5O2/c1-6-2-3-4-5-6;7-6(8)1-2-4-5-3-1/h2H,1H3;(H,2,3,4,5).
What are the key properties of 1-methyltetrazole;5-nitro-2H-tetrazole?
1-methyltetrazole;5-nitro-2H-tetrazole has a molecular weight of 199.13 g/mol, XLogP of -1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltetrazole;5-nitro-2H-tetrazole is sourced from PubChem (CID 146465693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).