C5H4N8O2 — CID 135448368
N-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazin-3-amine (PubChem CID 135448368) has the molecular formula C5H4N8O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is N-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 135448368 |
| Molecular Formula | C5H4N8O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | N-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazin-3-amine |
| SMILES | O=[N+]([O-])c1nc(Nc2nccnn2)n[nH]1 |
| InChI | InChI=1S/C5H4N8O2/c14-13(15)5-9-4(11-12-5)8-3-6-1-2-7-10-3/h1-2H,(H2,6,8,9,10,11,12) |
| InChIKey | QNLYDWIWNDVMBR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|