C11H7ClN6O2S — CID 15485699
N-[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 15485699) has the molecular formula C11H7ClN6O2S and a molecular weight of 322.74 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 15485699 |
| Molecular Formula | C11H7ClN6O2S |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2n[nH]c(-c3ccc(Cl)cc3)n2)s1 |
| InChI | InChI=1S/C11H7ClN6O2S/c12-7-3-1-6(2-4-7)9-14-10(17-16-9)15-11-13-5-8(21-11)18(19)20/h1-5H,(H2,13,14,15,16,17) |
| InChIKey | OGEIUJDVYCQVBJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|