C14H21IN8O2 — CID 159058612
iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)-5-nitropyrimidin-4-amine (PubChem CID 159058612) has the molecular formula C14H21IN8O2 and a molecular weight of 460.28 g/mol. Its IUPAC name is iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)-5-nitropyrimidin-4-amine.
| Compound Name | iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 159058612 |
| Molecular Formula | C14H21IN8O2 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | iodomethane;2-(4-methylpiperidin-1-yl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)-5-nitropyrimidin-4-amine |
| SMILES | CI.Cc1nc(Nc2nc(N3CCC(C)CC3)ncc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C13H18N8O2.CH3I/c1-8-3-5-20(6-4-8)13-14-7-10(21(22)23)11(17-13)16-12-15-9(2)18-19-12;1-2/h7-8H,3-6H2,1-2H3,(H2,14,15,16,17,18,19);1H3 |
| InChIKey | JYEHCMBGBDJLJM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|