C12H16N8O2 — CID 133363804
2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 133363804) has the molecular formula C12H16N8O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 133363804 |
| Molecular Formula | C12H16N8O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1nc(C2CCCN(c3ncc([N+](=O)[O-])c(N)n3)C2)n[nH]1 |
| InChI | InChI=1S/C12H16N8O2/c1-7-15-11(18-17-7)8-3-2-4-19(6-8)12-14-5-9(20(21)22)10(13)16-12/h5,8H,2-4,6H2,1H3,(H2,13,14,16)(H,15,17,18) |
| InChIKey | SFOGCOOVIIEFMT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|