C13H17N7O2S — CID 133481384
N-[1-(4-amino-5-nitropyrimidin-2-yl)piperidin-4-yl]-4-methyl-1,3-thiazol-2-amine (PubChem CID 133481384) has the molecular formula C13H17N7O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[1-(4-amino-5-nitropyrimidin-2-yl)piperidin-4-yl]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[1-(4-amino-5-nitropyrimidin-2-yl)piperidin-4-yl]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133481384 |
| Molecular Formula | C13H17N7O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[1-(4-amino-5-nitropyrimidin-2-yl)piperidin-4-yl]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NC2CCN(c3ncc([N+](=O)[O-])c(N)n3)CC2)n1 |
| InChI | InChI=1S/C13H17N7O2S/c1-8-7-23-13(16-8)17-9-2-4-19(5-3-9)12-15-6-10(20(21)22)11(14)18-12/h6-7,9H,2-5H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | PANSOVYBYFEAIY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|