C15H22N6O2 — CID 129378362
2-[4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 129378362) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-[4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 129378362 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[4-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | Nc1nc(N2CCN([C@@H]3C[C@H]4CC[C@H]3C4)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N6O2/c16-14-13(21(22)23)9-17-15(18-14)20-5-3-19(4-6-20)12-8-10-1-2-11(12)7-10/h9-12H,1-8H2,(H2,16,17,18)/t10-,11-,12+/m0/s1 |
| InChIKey | VUSXIOKUFWSOIO-SDDRHHMPSA-N |
| XLogP | 1.28 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|