C16H19N7O3 — CID 60501112
2-[4-(4-amino-5-nitropyrimidin-2-yl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 60501112) has the molecular formula C16H19N7O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[4-(4-amino-5-nitropyrimidin-2-yl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | 2-[4-(4-amino-5-nitropyrimidin-2-yl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 60501112 |
| Molecular Formula | C16H19N7O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[4-(4-amino-5-nitropyrimidin-2-yl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | NC(=O)C(c1ccccc1)N1CCN(c2ncc([N+](=O)[O-])c(N)n2)CC1 |
| InChI | InChI=1S/C16H19N7O3/c17-14-12(23(25)26)10-19-16(20-14)22-8-6-21(7-9-22)13(15(18)24)11-4-2-1-3-5-11/h1-5,10,13H,6-9H2,(H2,18,24)(H2,17,19,20) |
| InChIKey | BDPXLJKPEFJUDW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|