C9H11N5O4 — CID 122059846
(2S)-1-(4-amino-5-nitropyrimidin-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 122059846) has the molecular formula C9H11N5O4 and a molecular weight of 253.22 g/mol. Its IUPAC name is (2S)-1-(4-amino-5-nitropyrimidin-2-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-amino-5-nitropyrimidin-2-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122059846 |
| Molecular Formula | C9H11N5O4 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2S)-1-(4-amino-5-nitropyrimidin-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | Nc1nc(N2CCC[C@H]2C(=O)O)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O4/c10-7-6(14(17)18)4-11-9(12-7)13-3-1-2-5(13)8(15)16/h4-5H,1-3H2,(H,15,16)(H2,10,11,12)/t5-/m0/s1 |
| InChIKey | HVYLYBMEACAAFB-YFKPBYRVSA-N |
| XLogP | 0.02 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|