C8H11N5O2 — CID 47204491
5-nitro-2-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 47204491) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 5-nitro-2-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | 5-nitro-2-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 47204491 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 5-nitro-2-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | Nc1nc(N2CCCC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N5O2/c9-7-6(13(14)15)5-10-8(11-7)12-3-1-2-4-12/h5H,1-4H2,(H2,9,10,11) |
| InChIKey | AHSCQRMHTTVJGK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|