C15H16ClN7O3 — CID 133270087
1-(4-amino-5-nitropyrimidin-2-yl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 133270087) has the molecular formula C15H16ClN7O3 and a molecular weight of 377.79 g/mol. Its IUPAC name is 1-(4-amino-5-nitropyrimidin-2-yl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-amino-5-nitropyrimidin-2-yl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133270087 |
| Molecular Formula | C15H16ClN7O3 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-(4-amino-5-nitropyrimidin-2-yl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Nc1nc(N2CCCC(C(=O)Nc3ccc(Cl)cn3)C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16ClN7O3/c16-10-3-4-12(18-6-10)20-14(24)9-2-1-5-22(8-9)15-19-7-11(23(25)26)13(17)21-15/h3-4,6-7,9H,1-2,5,8H2,(H2,17,19,21)(H,18,20,24) |
| InChIKey | VZUXUCWDJLJSIM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|