C18H18ClN7O — CID 55922538
N-(5-chloro-2-pyridinyl)-1-(6-pyrazol-1-ylpyrazin-2-yl)piperidine-3-carboxamide (PubChem CID 55922538) has the molecular formula C18H18ClN7O and a molecular weight of 383.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-(6-pyrazol-1-ylpyrazin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-(6-pyrazol-1-ylpyrazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55922538 |
| Molecular Formula | C18H18ClN7O |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-(6-pyrazol-1-ylpyrazin-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1CCCN(c2cncc(-n3cccn3)n2)C1 |
| InChI | InChI=1S/C18H18ClN7O/c19-14-4-5-15(21-9-14)23-18(27)13-3-1-7-25(12-13)16-10-20-11-17(24-16)26-8-2-6-22-26/h2,4-6,8-11,13H,1,3,7,12H2,(H,21,23,27) |
| InChIKey | USKQXMBALAUKSJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |