C21H20ClN5O2 — CID 167808965
N-[5-(4-chlorophenoxy)-2-pyridinyl]-1-pyrazin-2-ylpiperidine-3-carboxamide (PubChem CID 167808965) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N-[5-(4-chlorophenoxy)-2-pyridinyl]-1-pyrazin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[5-(4-chlorophenoxy)-2-pyridinyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 167808965 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[5-(4-chlorophenoxy)-2-pyridinyl]-1-pyrazin-2-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)cn1)C1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C21H20ClN5O2/c22-16-3-5-17(6-4-16)29-18-7-8-19(25-12-18)26-21(28)15-2-1-11-27(14-15)20-13-23-9-10-24-20/h3-10,12-13,15H,1-2,11,14H2,(H,25,26,28) |
| InChIKey | BKRVVBMILKQCIP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |