C22H28ClN5O2 — CID 42954799
[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone (PubChem CID 42954799) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is [4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone.
| Compound Name | [4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 42954799 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | [4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone |
| SMILES | O=C(C1CCCN(c2cnccn2)C1)N1CCN(CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H28ClN5O2/c23-19-3-5-20(6-4-19)30-15-14-26-10-12-27(13-11-26)22(29)18-2-1-9-28(17-18)21-16-24-7-8-25-21/h3-8,16,18H,1-2,9-15,17H2 |
| InChIKey | JJWKQZZKNDWQLQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |