C22H29N5O2 — CID 51934537
[4-(2-phenoxyethyl)piperazin-1-yl]-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]methanone (PubChem CID 51934537) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is [4-(2-phenoxyethyl)piperazin-1-yl]-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]methanone.
| Compound Name | [4-(2-phenoxyethyl)piperazin-1-yl]-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 51934537 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [4-(2-phenoxyethyl)piperazin-1-yl]-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(c2cnccn2)C1)N1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c28-22(19-5-4-10-27(18-19)21-17-23-8-9-24-21)26-13-11-25(12-14-26)15-16-29-20-6-2-1-3-7-20/h1-3,6-9,17,19H,4-5,10-16,18H2/t19-/m1/s1 |
| InChIKey | VYYNFIRJGIYXHA-LJQANCHMSA-N |
| XLogP | 1.92 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |