C17H24N2O2 — CID 165435335
cyclopropyl-[4-(2-phenoxyethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 165435335) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is cyclopropyl-[4-(2-phenoxyethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2-phenoxyethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 165435335 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | cyclopropyl-[4-(2-phenoxyethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O2/c20-17(15-7-8-15)19-10-4-9-18(11-12-19)13-14-21-16-5-2-1-3-6-16/h1-3,5-6,15H,4,7-14H2 |
| InChIKey | RCHINLDTFCHLIK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |