C23H31N5O3 — CID 42954798
[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone (PubChem CID 42954798) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is [4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone.
| Compound Name | [4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 42954798 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | [4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-(1-pyrazin-2-ylpiperidin-3-yl)methanone |
| SMILES | COc1ccc(OCCN2CCN(C(=O)C3CCCN(c4cnccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C23H31N5O3/c1-30-20-4-6-21(7-5-20)31-16-15-26-11-13-27(14-12-26)23(29)19-3-2-10-28(18-19)22-17-24-8-9-25-22/h4-9,17,19H,2-3,10-16,18H2,1H3 |
| InChIKey | LAFYCESHAHRLRD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |