C12H10BrN5O2 — CID 133471701
2-(5-bromo-1,3-dihydroisoindol-2-yl)-5-nitropyrimidin-4-amine (PubChem CID 133471701) has the molecular formula C12H10BrN5O2 and a molecular weight of 336.15 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dihydroisoindol-2-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 2-(5-bromo-1,3-dihydroisoindol-2-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 133471701 |
| Molecular Formula | C12H10BrN5O2 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-(5-bromo-1,3-dihydroisoindol-2-yl)-5-nitropyrimidin-4-amine |
| SMILES | Nc1nc(N2Cc3ccc(Br)cc3C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10BrN5O2/c13-9-2-1-7-5-17(6-8(7)3-9)12-15-4-10(18(19)20)11(14)16-12/h1-4H,5-6H2,(H2,14,15,16) |
| InChIKey | YLFMWLYSLLQNDX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|