C13H13BrN4O — CID 106998391
2-(5-bromo-4-methoxypyrimidin-2-yl)-1,3-dihydroisoindol-5-amine (PubChem CID 106998391) has the molecular formula C13H13BrN4O and a molecular weight of 321.18 g/mol. Its IUPAC name is 2-(5-bromo-4-methoxypyrimidin-2-yl)-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-(5-bromo-4-methoxypyrimidin-2-yl)-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 106998391 |
| Molecular Formula | C13H13BrN4O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-(5-bromo-4-methoxypyrimidin-2-yl)-1,3-dihydroisoindol-5-amine |
| SMILES | COc1nc(N2Cc3ccc(N)cc3C2)ncc1Br |
| InChI | InChI=1S/C13H13BrN4O/c1-19-12-11(14)5-16-13(17-12)18-6-8-2-3-10(15)4-9(8)7-18/h2-5H,6-7,15H2,1H3 |
| InChIKey | IEIIPOBYTSWRSM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|