C13H11BrN6O — CID 106998496
3-[1-(5-bromo-4-methoxypyrimidin-2-yl)-1,2,4-triazol-3-yl]aniline (PubChem CID 106998496) has the molecular formula C13H11BrN6O and a molecular weight of 347.18 g/mol. Its IUPAC name is 3-[1-(5-bromo-4-methoxypyrimidin-2-yl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-(5-bromo-4-methoxypyrimidin-2-yl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 106998496 |
| Molecular Formula | C13H11BrN6O |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-[1-(5-bromo-4-methoxypyrimidin-2-yl)-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1nc(-n2cnc(-c3cccc(N)c3)n2)ncc1Br |
| InChI | InChI=1S/C13H11BrN6O/c1-21-12-10(14)6-16-13(18-12)20-7-17-11(19-20)8-3-2-4-9(15)5-8/h2-7H,15H2,1H3 |
| InChIKey | ICVIYQDDEIQLDO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|