C12H16N4O — CID 113384275
3-[1-(3-methoxypropyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 113384275) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-[1-(3-methoxypropyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-(3-methoxypropyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 113384275 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-[1-(3-methoxypropyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | COCCCn1cnc(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C12H16N4O/c1-17-7-3-6-16-9-14-12(15-16)10-4-2-5-11(13)8-10/h2,4-5,8-9H,3,6-7,13H2,1H3 |
| InChIKey | HFGRGCPWQDLITM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|