C13H17FN4 — CID 114280236
3-[1-(5-fluoropentyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 114280236) has the molecular formula C13H17FN4 and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-[1-(5-fluoropentyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-(5-fluoropentyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 114280236 |
| Molecular Formula | C13H17FN4 |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-[1-(5-fluoropentyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2ncn(CCCCCF)n2)c1 |
| InChI | InChI=1S/C13H17FN4/c14-7-2-1-3-8-18-10-16-13(17-18)11-5-4-6-12(15)9-11/h4-6,9-10H,1-3,7-8,15H2 |
| InChIKey | VVMFPRZSDKOMHO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|