C15H20N4O — CID 116521790
3-[1-[(5,5-dimethyloxolan-2-yl)methyl]-1,2,4-triazol-3-yl]aniline (PubChem CID 116521790) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[1-[(5,5-dimethyloxolan-2-yl)methyl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-[(5,5-dimethyloxolan-2-yl)methyl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 116521790 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-[1-[(5,5-dimethyloxolan-2-yl)methyl]-1,2,4-triazol-3-yl]aniline |
| SMILES | CC1(C)CCC(Cn2cnc(-c3cccc(N)c3)n2)O1 |
| InChI | InChI=1S/C15H20N4O/c1-15(2)7-6-13(20-15)9-19-10-17-14(18-19)11-4-3-5-12(16)8-11/h3-5,8,10,13H,6-7,9,16H2,1-2H3 |
| InChIKey | PTULJLPTDHHHIH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|