C11H17IN2O — CID 116525428
1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodo-4-methylpyrazole (PubChem CID 116525428) has the molecular formula C11H17IN2O and a molecular weight of 320.17 g/mol. Its IUPAC name is 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodo-4-methylpyrazole.
| Compound Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodo-4-methylpyrazole |
|---|---|
| PubChem CID | 116525428 |
| Molecular Formula | C11H17IN2O |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodo-4-methylpyrazole |
| SMILES | Cc1cn(CC2CCC(C)(C)O2)nc1I |
| InChI | InChI=1S/C11H17IN2O/c1-8-6-14(13-10(8)12)7-9-4-5-11(2,3)15-9/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | SZQVLZSJBREEFU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|