C10H14BrIN2O — CID 116525409
4-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodopyrazole (PubChem CID 116525409) has the molecular formula C10H14BrIN2O and a molecular weight of 385.04 g/mol. Its IUPAC name is 4-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodopyrazole.
| Compound Name | 4-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodopyrazole |
|---|---|
| PubChem CID | 116525409 |
| Molecular Formula | C10H14BrIN2O |
| Molecular Weight | 385.04 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 4-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]-3-iodopyrazole |
| SMILES | CC1(C)CCC(Cn2cc(Br)c(I)n2)O1 |
| InChI | InChI=1S/C10H14BrIN2O/c1-10(2)4-3-7(15-10)5-14-6-8(11)9(12)13-14/h6-7H,3-5H2,1-2H3 |
| InChIKey | VIKJTIOFAQAZJP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.04 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|