C13H16N4O — CID 106929503
3-[1-(cyclopropylmethoxymethyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 106929503) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-[1-(cyclopropylmethoxymethyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-(cyclopropylmethoxymethyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 106929503 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-[1-(cyclopropylmethoxymethyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2ncn(COCC3CC3)n2)c1 |
| InChI | InChI=1S/C13H16N4O/c14-12-3-1-2-11(6-12)13-15-8-17(16-13)9-18-7-10-4-5-10/h1-3,6,8,10H,4-5,7,9,14H2 |
| InChIKey | XDVIRIIQVZEBSV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|