C12H15N3 — CID 70871357
1-ethyl-3-(3-ethylphenyl)-1,2,4-triazole (PubChem CID 70871357) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylphenyl)-1,2,4-triazole.
| Compound Name | 1-ethyl-3-(3-ethylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 70871357 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-ethyl-3-(3-ethylphenyl)-1,2,4-triazole |
| SMILES | CCc1cccc(-c2ncn(CC)n2)c1 |
| InChI | InChI=1S/C12H15N3/c1-3-10-6-5-7-11(8-10)12-13-9-15(4-2)14-12/h5-9H,3-4H2,1-2H3 |
| InChIKey | OAJKIVVVTLMGLW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |