C9H9N3 — CID 22458
1-benzyl-1,2,4-triazole (PubChem CID 22458) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-benzyl-1,2,4-triazole.
| Compound Name | 1-benzyl-1,2,4-triazole |
|---|---|
| PubChem CID | 22458 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1-benzyl-1,2,4-triazole |
| SMILES | c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C9H9N3/c1-2-4-9(5-3-1)6-12-8-10-7-11-12/h1-5,7-8H,6H2 |
| InChIKey | BNWQEHYYXTVKOF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |