C10H8N4 — CID 7537616
4-(1,2,4-triazol-1-ylmethyl)benzonitrile (PubChem CID 7537616) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-ylmethyl)benzonitrile.
| Compound Name | 4-(1,2,4-triazol-1-ylmethyl)benzonitrile |
|---|---|
| PubChem CID | 7537616 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-(1,2,4-triazol-1-ylmethyl)benzonitrile |
| SMILES | N#Cc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C10H8N4/c11-5-9-1-3-10(4-2-9)6-14-8-12-7-13-14/h1-4,7-8H,6H2 |
| InChIKey | HQLYWHSJALKYOV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |