C9H10N4 — CID 821219
4-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 821219) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | 4-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 821219 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 4-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | Nc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C9H10N4/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13/h1-4,6-7H,5,10H2 |
| InChIKey | ZGLQVRIVLWGDNA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|