C9H7ClFN3 — CID 107887752
1-[(4-chloro-3-fluorophenyl)methyl]-1,2,4-triazole (PubChem CID 107887752) has the molecular formula C9H7ClFN3 and a molecular weight of 211.63 g/mol. Its IUPAC name is 1-[(4-chloro-3-fluorophenyl)methyl]-1,2,4-triazole.
| Compound Name | 1-[(4-chloro-3-fluorophenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 107887752 |
| Molecular Formula | C9H7ClFN3 |
| Molecular Weight | 211.63 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 1-[(4-chloro-3-fluorophenyl)methyl]-1,2,4-triazole |
| SMILES | Fc1cc(Cn2cncn2)ccc1Cl |
| InChI | InChI=1S/C9H7ClFN3/c10-8-2-1-7(3-9(8)11)4-14-6-12-5-13-14/h1-3,5-6H,4H2 |
| InChIKey | WUXPETUQGUSRQR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.63 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |