C10H12N4 — CID 3322898
N-methyl-4-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 3322898) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is N-methyl-4-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | N-methyl-4-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 3322898 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N-methyl-4-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | CNc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C10H12N4/c1-11-10-4-2-9(3-5-10)6-14-8-12-7-13-14/h2-5,7-8,11H,6H2,1H3 |
| InChIKey | MSZOCLIGUCYDIA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |