C20H16N8O — CID 102089796
2,5-bis[4-(1,2,4-triazol-1-ylmethyl)phenyl]-1,3,4-oxadiazole (PubChem CID 102089796) has the molecular formula C20H16N8O and a molecular weight of 384.40 g/mol. Its IUPAC name is 2,5-bis[4-(1,2,4-triazol-1-ylmethyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[4-(1,2,4-triazol-1-ylmethyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 102089796 |
| Molecular Formula | C20H16N8O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2,5-bis[4-(1,2,4-triazol-1-ylmethyl)phenyl]-1,3,4-oxadiazole |
| SMILES | c1ncn(Cc2ccc(-c3nnc(-c4ccc(Cn5cncn5)cc4)o3)cc2)n1 |
| InChI | InChI=1S/C20H16N8O/c1-5-17(6-2-15(1)9-27-13-21-11-23-27)19-25-26-20(29-19)18-7-3-16(4-8-18)10-28-14-22-12-24-28/h1-8,11-14H,9-10H2 |
| InChIKey | LMMBEQNKQZDOOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |