C16H15N5 — CID 24698268
2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzenecarboximidamide (PubChem CID 24698268) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzenecarboximidamide.
| Compound Name | 2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 24698268 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[4-(1,2,4-triazol-1-ylmethyl)phenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1-c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C16H15N5/c17-16(18)15-4-2-1-3-14(15)13-7-5-12(6-8-13)9-21-11-19-10-20-21/h1-8,10-11H,9H2,(H3,17,18) |
| InChIKey | ICNXAGNYWUNBEM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|