C17H15N3 — CID 91983064
1-[(Z)-2,3-diphenylprop-2-enyl]-1,2,4-triazole (PubChem CID 91983064) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-[(Z)-2,3-diphenylprop-2-enyl]-1,2,4-triazole.
| Compound Name | 1-[(Z)-2,3-diphenylprop-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 91983064 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[(Z)-2,3-diphenylprop-2-enyl]-1,2,4-triazole |
| SMILES | C(=C(\Cn1cncn1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C17H15N3/c1-3-7-15(8-4-1)11-17(12-20-14-18-13-19-20)16-9-5-2-6-10-16/h1-11,13-14H,12H2/b17-11+ |
| InChIKey | JZIVAIIDXPQMJN-GZTJUZNOSA-N |
| XLogP | 3.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|