C10H11N3O3S — CID 162357919
[4-(1,2,4-triazol-1-ylmethyl)phenyl] methanesulfonate (PubChem CID 162357919) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is [4-(1,2,4-triazol-1-ylmethyl)phenyl] methanesulfonate.
| Compound Name | [4-(1,2,4-triazol-1-ylmethyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 162357919 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | [4-(1,2,4-triazol-1-ylmethyl)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C10H11N3O3S/c1-17(14,15)16-10-4-2-9(3-5-10)6-13-8-11-7-12-13/h2-5,7-8H,6H2,1H3 |
| InChIKey | URWLVHPHKODHJB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|